Giáo án môn Hóa học - Chuyên đề: Cacbohiđrat

I. NỘI DUNG CHUYÊN ĐỀ:

 1.NỘI DUNG 1: GLUCOZƠ + FRUCTOZƠ

 a.Cấu tạo mạch hở của glucozơ và fructozơ:

 + Khử hoàn toàn bằng H2/Ni, to , glucozơ và fructozơ tạo hexan  6 nguyên tử C tạo mạch không phân nhánh.

 + Hòa tan kết tủa Cu(OH)2/NaOH cho dung dịch màu xanh lam có nhiều nhóm OH kề nhau.

 + Tạo este có 5 gốc axit  phân tử có 5 nhóm OH.

CHÚ Ý:

 + Để chứng minh nhóm CH=O trong glucozơ ngoài phản ứng tráng bạc, cần dùng phản ứng làm mất màu Br2.

+ Do cân bằng fructozơ glucozơ nên fructozơ (đồng phân xeton) cũng có thể tham gia phản ứng tráng bạc.

+ Dung dịch Br2 không có môi trường kiềm nên không xảy ra chuyển hóa trên, do đó fructozơ không bị oxi hóa bởi nước Br2. (đây cũng là phản ứng phân biệt glucozơ với fructozơ)

 

doc 11 trang Người đăng trung218 Ngày đăng 06/04/2017 Lượt xem 245Lượt tải 8 Download
Bạn đang xem tài liệu "Giáo án môn Hóa học - Chuyên đề: Cacbohiđrat", để tải tài liệu gốc về máy bạn click vào nút DOWNLOAD ở trên
ĐOÀN LÂM ĐỒNG - TẬP HUẤN CHUYÊN MÔN TẠI ĐĂKLĂK 
TÊN CHUYÊN ĐỀ: CACBOHIĐRAT
I. NỘI DUNG CHUYÊN ĐỀ:
 1.NỘI DUNG 1: GLUCOZƠ + FRUCTOZƠ
 a.Cấu tạo mạch hở của glucozơ và fructozơ:
	+ Khử hoàn toàn bằng H2/Ni, to , glucozơ và fructozơ tạo hexan ® 6 nguyên tử C tạo mạch không phân nhánh.
	+ Hòa tan kết tủa Cu(OH)2/NaOH cho dung dịch màu xanh lam® có nhiều nhóm OH kề nhau.
	+ Tạo este có 5 gốc axit ® phân tử có 5 nhóm OH.
CHÚ Ý: 
	+ Để chứng minh nhóm CH=O trong glucozơ ngoài phản ứng tráng bạc, cần dùng phản ứng làm mất màu Br2. 
+ Do cân bằng fructozơ glucozơ nên fructozơ (đồng phân xeton) cũng có thể tham gia phản ứng tráng bạc. 
+ Dung dịch Br2 không có môi trường kiềm nên không xảy ra chuyển hóa trên, do đó fructozơ không bị oxi hóa bởi nước Br2. (đây cũng là phản ứng phân biệt glucozơ với fructozơ)
 b. Tính chất hóa học cơ bản của glucozơ:
+ Phản ứng của ancol đa chức: hòa tan Cu(OH)2¯ và estehóa với anhiđrit axit.
+ Phản ứng của anđehit: bị khử thành ancol có 6 nhóm OH, bị oxi hóa bởi dung dịch AgNO3/NH3 tạo ¯Ag (phản ứng tráng bạc) 
+ Phản ứng lên men tạo ancol etylic.
 c. Sản xuất:
+ Thủy phân tinh bột.
+ Trong tự nhiên, quá trình quang hợp ® tinh bột trong cây xanh ® glucozơ, fructozơ
 d. Ứng dụng:
+ Huyết thanh ngọt, tráng gương
 e. Luyện tập: 
+ Viết cấu tạo mạch hở của glucozơ và fructozơ. 
 	+ Phân biệt dung dịch glucozơ với glixerol.
 	+ Phân biệt dung dịch glucozơ với anđehit. 
+ Viết phương trình hóa học các phản ứng biểu diễn tính chất hóa học, từ đó tính khối lượng glucozơ phản ứng, khối lượng ancol tạo ra...
+ Tính toán các bài tập đơn giản liên quan đến tính chất glucozơ.
 2. NỘI DUNG 2: SACCAROZƠ + TINH BỘT – XENLULOZƠ
 a. Đặc điểm cấu tạo:
+ Saccarozơ, đisaccarit: C12H22O11 (cấu tạo từ 1 gốc glucozơ + 1 gốc fructozơ), phân tử không chứa nhóm CH=O. 
+ Tinh bột, polisaccarit: (C6H10O5)n (cấu tạo từ nhiều mắt xích a+glucozơ), ở hai dạng cấu trúc mạch phân nhánh (amilopectin) và không phân nhánh (amilozơ) 
+ Xenlulozơ, polisaccarit: (C6H10O5)n (cấu tạo từ nhiều mắt xích b+glucozơ), chỉ có cấu tạo mạch không phân nhánh, mỗi mắt xích chứa 3 nhóm OH : [C6H7O2(OH)3 ]n.
 b. Tính chất hóa học cơ bản:
+ Saccarozơ: có phản ứng của poliancol (hòa tan Cu(OH)2¯ thành dung dịch màu xanh), không dự phản ứng tráng bạc (vì phân tử không có nhóm CH=O) và có phản ứng thủy phân tạo glucozơ và fructozơ.
+ Tinh bột: có phản ứng thủy phân và phản ứng màu với iot
+ Xenlulozơ: có phản ứng thủy phân và phản ứng với axit HNO3 (xảy ra ở 3 nhóm -OH) 
 c. Ứng dụng:
+ Saccarozơ: công nghiệp thực phẩm.
+ Tinh bột: thực phẩm, sản xuất glucozo, sản xuất rượu.
+ Xenlulozơ: sản xuất tơ sợi, xây dựng, đồ mỹ nghệ.
 d. Luyện tập: 
+ Viết phương trình hóa học các phản ứng thủy phân saccarozơ, tinh bột và xenlulozơ; phản ứng este hóa của xenlulozơ với (CH3CO)2O đun nóng, HNO3/H2SO4đ; với CH3COOH/H2SO4 đ (đun nóng).
+ Phân biệt các dung dịch : saccarozơ, glucozơ, andehit axetic.
+ Tính khối lượng Ag hoặc glucozơ thu được khi thủy phân saccarozơ, tinh bột và xenlulozơ, rồi cho sản phẩm dự phản ứng tráng bạc.
II. TỔ CHỨC DẠY HỌC CHUYÊN ĐỀ:
 1. Chuẩn kiến thức và kỹ năng
 a.Kiến thức 
* Biết được:
+ Khái niệm, phân loại cacbohiđrat. 
+ Công thức cấu tạo dạng mạch hở, tính chất vật lí (trạng thái, màu, mùi, nhiệt độ nóng chảy, độ tan), ứng dụng của glucozơ.
 + Công thức phân tử, đặc điểm cấu tạo, tính chất vật lí, ( trạng thái, màu, độ tan) của saccarozơ, tinh bột và xenlulozơ.
* Hiểu được:
+ Tính chất hóa học của glucozơ: Tính chất của ancol đa chức, anđehit đơn chức; phản ứng lên men rượu.
+ Tính chất hóa học của saccarozơ: Thủy phân và tác dụng Cu(OH)2/NaOH.
	+ Tính chất hóa học của tinh bột và xenlulozơ: Tính chất chung (thuỷ phân), tính chất riêng (phản ứng của hồ tinh bột với iot, phản ứng của xenlulozơ với axit HNO3); ứng dụng.
* Vận dụng:
+ Viết được các phương trình phản ứng của:
 	 - Glucozơ với H2, Cu(OH)2, tráng bạc, dung dịch Br2.
 - Fructozơ với H2.
 - Saccarozơ thủy phân.
 - Tinh bột thủy phân.
 - Xenlulozơ thủy phân, tác dụng HNO3.
 +Phân biệt dung dịch glucozơ với glixerol, glucozơ với fructozơ bằng phương pháp hoá học.
 b.Kĩ năng 
+ Quan sát: mẫu vật: đường nho, mật ong, đường phèn, tinh bột, sợi bông.
+ Làm thí nghiệm: tráng bạc, tác dụng Cu(OH)2 /OH.
+ Tính toán: giải các dạng bài toán.
 c. Thái độ:
+ Giáo dục cho học sinh đức tính cẩn thận, chính xác.
+ Nhận thức được vai trò cacbohidrat trong đời sống.
 d. Định hướng các năng lực được hình thành:
+ Năng lực hợp tác.
+ Năng lực giao tiếp.
+ Năng lực giải quyết vấn đề.
+ Năng lực tính toán hóa học.
+ Năng lực vận dụng kiến thức hóa học vào thực tiễn.
+ Năng lực thực hành hóa học.
+ Năng lực sử dụng ngôn ngữ hóa học.
 e. Trọng tâm
+ Công thức cấu tạo dạng mạch hở của glucozơ và fructozơ
+ Tính chất hóa học cơ bản của glucozơ (phản ứng của các nhóm chức và sự lên men) 
+ Quan sát mẫu vật thật, mô hình phân tử, làm thí nghiệm rút ra nhận xét.
+ Viết các PTHH minh hoạ cho tính chất hoá học.
+ Phân biệt các dung dịch : saccarozơ, glucozơ, glixerol bằng phương pháp hoá học.
+ Tính khối lượng glucozơ thu được từ phản ứng thuỷ phân các chất theo hiệu suất.
+ Đặc điểm cấu tạo phân tử của saccarozơ, tinh bột và xenlulozơ; 
+ Tính chất hóa học cơ bản của saccarozơ, tinh bột và xenlulozơ. 
2. Phương pháp dạy học:
	+ Vấn đáp, thuyết trình, nêu và giải quyết vấn đề,...
	+ Phương pháp góc, mảnh ghép, sơ đồ tư duy, thảo luận nhóm,...
3. Chuẩn bị:
 a. Giáo viên:
+ Dụng cụ: kẹp gỗ, ống nghiệm, đũa thủy tinh, đèn cồn thìa, ống nhỏ giọt, ống nghiệm nhỏ.
+ Hóa chất: glucozơ, tinh bột, các dung dịch: AgNO3, NH3, CuSO4, NaOH, I2.
+ Mô hình, hình vẽ phân tử glucozơ và fructozơ .
+ Các video thí nghiệm.
+ Phiếu học tập.
+ Giáo án powerpoint.
 b. Học sinh
+ Sách giáo khoa hóa học 12 cơ bản.
+ Chuẩn bị giấy A0, bút lông
4. NỘI DUNG: GLUCOZƠ
* Hoạt động 1 (mở đầu): (5 phút)
Giáo viên trình chiếu các sản phẩm có chứa hợp chất cacbohiđrat
	+ Glucozơ, fructozơ: quả nho chín, mật ong,
	+ Saccarozơ: cây mía, củ cải đường, hoa thốt nốt,...
	+ Tinh bột: gạo, khoai, ngô,...
	+ Xenlulozơ: sợi bông, gỗ, sợi đay,...
	Thông qua sản phẩm được trình chiếu, giáo viên cùng học sinh xây dựng khái niệm, phân loại hợp chất Cacbohiđrat đồng thời thông báo nhiệm vụ của việc nghiên cứu chương Cacbohiđrat (củng cố kiến thức về các nhóm chức anđehyt, poliol, nghiên cứu về các loại Cacbohiđrat.
* Hoạt động 2: Nghiên cứu tính chất vật lý và trạng thái tự nhiên (10 phút)
	GV sử dụng phương pháp dạy học theo góc.
GV chia thành 2 góc: góc quan sát, góc trải nghiệm.
	Góc quan sát: học sinh quan sát lọ thủy tinh chứa glucozơ (nêu trạng thái, màu sắc,...); qua quan sát các hình ảnh có chứa glucozơ (quả nho chín,...) yêu cầu học sinh nêu trạng thái tự nhiên.
	Góc trải nghiệm: giáo viên cho học sinh thử tính tan của Glucozơ ( nêu tính tan)
Hoạt động 3: Xác định công thức cấu tạo dạng mạch hở của Glucozơ (10 phút)
PHIẾU HỌC TẬP: GÓC "PHÂN TÍCH"
Xác định cấu tạo dạng mạch hở của Glucozơ
Nghiên cứu sách giáo khoa (cá nhân) trả lời các câu hỏi (bảng sau):
Stt
Tên thí nghiệm
Hiện tượng/kết quả
Kết luận (cấu tạo)
1
Tác dụng với Cu(OH)2 ở t0 thường
?
?
2
Tác dụng với dd AgNO3/dd NH3 đun nhẹ
?
?
3
Tác dụng với anhiđrit axetic
Tạo este chứa 5 gốc axetat
?
4
Khử hoàn toàn glucozo bằng H2
Tạo Hexan
?
=> Công thức cấu tạo dạng mạch hở của phân tử Glucozơ:
..............................................................................................................................................
PHIẾU HỖ TRỢ
Xác định cấu tạo dạng mạch hở của Glucozơ
Stt
Tên thí nghiệm
Hiện tượng/kết quả
Kết luận (cấu tạo)
1
Tác dụng với Cu(OH)2 ở t0 thường
Tạo dung dịch màu xanh lam
Có nhiều nhóm +OH (poliol)
2
Tác dụng với dd AgNO3/dd NH3 đun nhẹ
Tạo kết tủa Ag
Có nhóm +CHO (anđehyt)
3
Tác dụng với anhiđrit axetic
Tạo este chứa 5 gốc axetat
Có 5 nhóm +OH
4
Khử hoàn toàn glucozo
Tạo Hexan
Mạch thẳng
=> CTCT dạng mạch hở của phân tử Glucozơ:
 CH2OH[CHOH]4CHO 
Hoạt động 4: Tính chất hóa học của Glucozơ (15 phút)
Hoạt động nhóm (4 nhóm)
	Nhóm 1+3: làm thí nghiệm về tính chất của ancol đa chức (tác dụng với Cu(OH)2 ở t0 thường).
	Nhóm 2+4: làm thí nghiệm về tính chất của anđehit (tác dụng với dd AgNO3/dd NH3 đun nhẹ).
Sau khi các nhóm báo cáo kết quả thí nghiệm, giáo viên nhận xét, kết luận (giáo viên nêu đặc điểm công thức và suy ra tính chất hóa học của Glucozơ).
	Bổ sung 1: Phản ứng lên men rượu, yêu cầu học sinh liên hệ thực tế (Vận dụng kiến thức liên môn Sinh hoặc CN lớp 10): ví dụ nấu rượu, ngâm nho, dâu,...
	Bổ sung 2: Phản ứng cộng H2, ứng dụng tạo ra sản phẩm Sobitol có ứng dụng làm thuốc nhuận tràng,...
* Bài tập vận dụng: (5 phút)
Giáo viên phát phiếu học tập 
PHIẾU HỌC TẬP: 
Câu 1/ Phân biệt các dung dịch sau bằng phương pháp hóa học:
 Glucozơ; glixerol; axit axetic; fomalin
Cách nhận biết:
........................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................
Viết PTHH:
Câu 2/ Trong thực tế, người ta dùng phản ứng của Glucozơ với dung dịch AgNO3/ NH3 đun nhẹ, lấy dư. Để phủ hết một tấm gương, người ta phải dùng 43,2 g Ag. Khối lượng Glucozơ (g) phải dùng là
A. 36 B. 3,6 C. 1,8 D. 2,7
.......................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................
PHIẾU HỖ TRỢ: 
Câu 1/ Phân biệt các dung dịch sau bằng phương pháp hóa học:
 Glucozơ; glixerol; axit axetic; fomalin
Cách nhận biết (gợi ý):
+ Dùng quỳ tím: nhận biết axit axetic: quỳ tím hóa đỏ
+ Dùng Cu(OH)2 ở t0 thường: nhận biết fomalin: không hiện tượng
2 dung dịch glucozơ; glixerol đều tạo màu xanh lam.
+ Dùng dung dịch AgNO3/NH3 đun nhẹ, có kết tủa Ag là glucozơ, còn lại là glixerol.
Viết PTHH:
1/ 2C6H12O6 + Cu(OH)2®(C6H11O6)2Cu + 2H2O
2/ 2C3H8O3 + Cu(OH)2®(C3H7O3)2Cu + 2H2O
3/ CH2OH[CHOH]4CHO+2AgNO3+3NH3+H2O ® CH2OH[CHOH]4COONH4+ 2Ag+ 2NH4NO3
Trong thực tế, người ta dùng phản ứng của glucozơ với dung dịch AgNO3/ NH3 đun nhẹ, lấy dư. Để phủ hết một tấm gương, người ta phải dùng 43,2 g Ag. Khối lượng glucozơ (g) phải dùng là
Câu 2/ 
A. 36 B. 3,6 C. 1,8 D. 2,7
HD: C6H12O6 ® 2Ag↓
 180g  216g
 ? = 36g 43,2g
Hoạt động 5: Điều chế và ứng dụng (5 phút) 
	1. Điều chế: 
	Học sinh dựa vào sách giáo khoa nêu phương pháp điều chế glucozơ.
	Sự chuyển hóa thành glucozo từ tinh bột trong quá trình chuối chín.
(Trong tự nhiên, quá trình quang hợp ® tinh bột trong cây xanh ® glucozơ, fructozơ)
	2. Ứng dụng:
	+ Giáo viên trình chiếu một số ứng dụng của glucozơ (phích thủy, gương soi, dịch truyền trong y học, sản xuất Vitamin,...)
	+ Học sinh quan sát, kết hợp sách giáo khoa và kiến thức thực tế, nêu ứng dụng của Glucozơ.
Hoạt động 6: Đồng phân của Glucozơ: Fructozơ (7 phút)
Học sinh nghiên cứu sách giáo khoa và mô hình nêu:
 + Công thức cấu tạo dạng mạch hở của fructozơ.
 + Nêu tính chất vật lý, trạng thái tự nhiên của fructozơ.
 + Tính chất hóa học của Fructozơ (sử dụng phương pháp nêu vấn đề)
Giáo viên đặt vấn đề: 
 + Dựa vào công thức cấu tạo yêu cầu học sinh dự đoán tính chất hóa học của Fructozơ ?
(Học sinh sẽ không nêu được phản ứng tráng gương do fructozơ không có nhóm chức anđehit)
Giáo viên nhận xét, bổ sung kiến thức cho học sinh (sự chuyển hóa Fructozơ thành Glucozơ trong môi trường kiềm)
 + Yêu cầu học sinh phân biệt 2 dung dịch: glucozơ và fructozơ ?
	(Gợi ý: dùng nước Brom. học sinh giải thích)
Hoạt động 7: Sơ đồ tư duy (7 phút)
+ Sử dụng kĩ thuật phòng tranh.
+ Các nhóm học sinh hoàn thành bảng hệ thống hóa kiến thức theo nhóm, các nhóm theo dõi, trao đổi, phản biện và xây dựng sơ đồ tư duy hoàn chỉnh. 
+ Giáo viên hoàn thiện kết luận chung.
Hoạt động 8: (7 phút)
+ Sử dụng kĩ thuật mảnh ghép
+ Giáo viên có sẵn 8 mảnh ghép trên bảng, giáo viên phát ngẫu nhiên 8 mảnh cần ghép cho 4 nhóm.
+ Các nhóm lựa chọn những mảnh ghép đúng với những mảnh ghép có sẵn trên bảng của giáo viên để tạo thành một câu hoàn chỉnh.
CÂU
CỘT 1(Cho)
CỘT 2 (Học sinh làm)
1
Huyết thanh ngọt 
glucozơ
2
Monosaccarit gồm
glucozơ, fructozơ
3
Chất có nhiều trong mật ong
fructozơ
4
Nồng độ Glucozơ có trong máu người
0,1%
5
Glucozơ
làm mất màu dung dịch Brom
6
Nước ép chuối chín
phản ứng tráng bạc
7
Glucozơ, Fructozơ phản ứng với H2 
tạo Sobitol
8
Sản xuất Glucozơ
từ tinh bột
III. XÂY DỰNG BẢNG MÔ TẢ:
Nội dung
Loại câu hỏi bài tập
Nhận biết
Thông hiểu
Vận dụng 
Vận dụng cao
CACBOHIDRAT
Định tính
Học sinh biết:
+Công thức cacbohidrat
+Tính chất vật lý của cacbohidrat.
+Trạng thái tự nhiên.
+Ứng dụng của cacbohidrat.
+Chứng minh được công thức cấu tạo của glucozơ qua các phản ứng hóa học.
+Phân loại đựơc các Cacbohidrat.
+Viết được các phương trình phản ứng của: +Glucozơ với H2, Cu(OH)2, tráng bạc, dung dịch Br2.
+ Fructozơ với H2.
+Saccarozơ thủy phân.
+Tinh bột thủy phân.
+Xenlulozơ thủy phân, tác dụng HNO3.
Định lượng
+Hiểu được loại cacbohidrat nào tan trong nước, thủy phân, tác dụng Cu(OH)2, tráng bạc.
+Bài toán phản ứng tráng bạc.
+Bài toán phản ứng thủy phân.
+Bài toán lên men rượu.
+Bài toán thủy phân rồi cho sản phẩm lên men rượu.
+Bài toán thủy phân rồi cho sản phẩm tráng bạc.
Thực hành thí nghiệm
Và thực tiển
Thành phần của huyết thanh ngọt, mật ong , đường mía,
+Tại sao trong thực tế người ta chỉ dùng glucozơ để thực hiện các phản ứng tráng bạc.
Bài toán điều chế thuốc nổ TNX .
+Tìm công thức cacbohidrat.
IV. CÂU HỎI /BÀI TẬP KIỂM TRA
NHẬN BIẾT :
Câu 1: Cacbohidrat (hay gluxit, saccarit) là hợp chất hữu cơ
A. đa chức, có công thức chung là Cn(H2O)m. 	
B. tạp chức, thường có công thức chung là Cn(H2O)m.
C. chứa nhiều nhóm hidroxyl và nhóm cacboxyl. 
D. chỉ có nguồn gốc từ thực vật.
Câu 2: Trong phân tử cacbohiđrat luôn có nhóm chức
 A. axit.	B. xeton.	 C. ancol.	D. anđehit.
Câu 3: Chất thuộc loại đisaccarit là
	A. glucozơ.	 B. saccarozơ. 	C. xenlulozơ. 	D. fructozơ.
Câu 4: Dữ kiện thực nghiệm không dùng để chứng minh cấu tạo của glucozơ ở dạng mạch hở là
 A. Khử hoàn toàn glucozơ cho hexan. B. Glucozơ có phản ứng tráng bạc. 
 C. Glucozơ tạo este chứa 5 gốc axit. D. Glucozơ lên men tạo ancol etylic. 
Câu 5: Chất dùng làm thuốc tăng lực trong y học là 
	A. saccarozơ.	 B. mantozơ.	C. xenlulozơ. 	 D. glucozơ.
HIỂU:
Câu 6: Để xác định glucozơ trong nước tiểu của người bị bệnh đái tháo đường người ta dùng 
	A. axit axetic. 	 B. đồng (II) oxit.	C. natri hiđroxit. 	 D. bạc nitrát/NH3.
Câu 7:Chất nào có thể điều chế etanol bằng một phản ứng
	A. saccarozơ.	 B. mantozơ.	 C. xenlulozơ. 	 D. glucozơ.
Câu 8: Sobitol được dùng làm thuốc nhuận trường trong y học được tạo thành từ gluccozơ bằng cách 
	A. khử glucozơ bằng H2/Ni, to.	B. oxi hóa glucozơ bằng AgNO3/NH3.
	C. lên men ancol etylic.	D. glucozơ tác dụng với Cu(OH)2. 
Câu 9: Nhỏ dung dịch iốt vào miếng chuối xanh cho màu xanh tím vì trong miếng chuối xanh có
	A. glucozơ.	 B. fructozo.	 C. tinh bột.	D. saccarozơ.
Câu 10:Cơm cháy có vị ngọt hơn cơm không cháy, vỏ bánh mì có vị ngọt hơn ruột bánh mì là do dưới tác dụng của nhiệt và enzim làm xúc tác, một phần tinh bột đã bị thủy phân thành
A. saccarozơ.	 B. fructozơ.	C. xenlulozơ. 	 D. đectrin.
VẬN DỤNG:
 Câu 11:Để tráng bạc một chiếc gương soi, người ta phải đun nóng dung dịch chứa 36g glucozơ với lượng vừa đủ dung dịch AgNO3 trong amoniac. Khối lượng bạc (g) đã sinh ra bám vào mặt kính của gương là (biết các phản ứng xảy ra hoàn toàn)
A. 10,8.	B. 21,6.	C. 32,4.	D.43,2.
Câu 12: Khi thủy phân a gam saccarozơ trong môi trường axít thu được 81 gam hỗn hợp glucozơ và fructozơ. Giá trị của a là 
A. 76,95. B. 81. C. 80. D. 79,65.
Câu 13:Cho dãy các chất: glucozơ, xenlulozơ, metyl fomat, saccarozơ, tinh bột, fructozơ. Số chất trong dãy tham gia phản ứng tráng bạc là
A. 3.	B. 4.	C. 2.	 	D. 5.
Câu 14:Trong các chất sau:axit axetic, glixerol, glucozơ, ancol etylic, xenlulozơ, andehit axetic. Số chất hòa tan được Cu(OH)2 ở nhiệt độ thường là
A. 3.	B. 5.	C. 1.	D. 4.
Câu 15: Cho 22,5 g glucozơ lên men rượu thoát ra 4,48 lít CO2 (đktc). Hiệu suất của quá trình lên men là
A. 85%. B. 80%. C. 70%. 	D. 75%. 
VẬN DỤNG CAO:
Câu 16: Đốt cháy hoàn toàn 16,2 gam một cacbohiđrat X thu được 13,44 lít CO2 (đktc) và 9,0 gam nước. Công thức đơn giản nhất của X là 
A. C6H12O6. B. C6H10O5. C. C12H22O11. D. CH2O. 
Câu 17:Thủy phân 100 gam saccarozơ, sau đó tiến hành phản ứng tráng bạc. Giả thiết các phản ứng xảy ra hoàn toàn, khối lượng bạc (gam) tạo ra là
A. 126,32.	 B. 123,62.	 C. 63,155. D. 65,315.
Câu 18: Glucozơ lên men thành ancol etylic, toàn bộ khi sinh ra được hết vào dung dịch Ca(OH)2 dư tách ra 40 gam kết tủa, biết hiệu suất lên men đạt 75%. Lượng glucozơ cần dùng là
A. 24 gam. 	B. 40 gam. C. 50 gam.	D. 48 gam.
Câu 19: Xenlulozơ trinitrat được điều chế từ xenlulozơ và axít nitric đặc có xúc tác H2SO4 đặc, nóng. Để có 2,97 kg xenlulozơ trinitrat, cần dùng dung dịch chứa m (kg) HNO3. Giả thiết hiệu suất toàn bộ quá trình là 75%. Giá trị của m (kg ) là
A. 1,4175. 	B. 2,25. 	C.1,89.	D.2,52.
Câu 20: Cho 2,5 kg glucozơ chứa 20% tạp chất lên men thành rượu. Tính thể tích rượu 400 thu được, biết rượu nguyên chất có khối lượng riêng 0,8 g/ml và trong quá trình chế biến, rượu bị hao hụt mất 10%.
	A. 3194,4 ml. 	B. 2785,0 ml. C. 2875,0 ml.	D. 2300,0 ml.

Tài liệu đính kèm:

  • docLam Dong- Cacbohidrat.doc